CAS 1391054-08-2 is the registry number for ent-Florfenicol Amine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg.
(1S,2R)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride (CAS 1391054-08-2) is a chemical compound with the molecular formula C10H15ClFNO3S and a molecular weight of 283.75 g/mol. IUPAC name: (1S,2R)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride. InChIKey: HWPBPTAOXVIKGI-IYPAPVHQSA-N.
| Molecular formula | C10H15ClFNO3S |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | (1S,2R)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride |
| InChIKey | HWPBPTAOXVIKGI-IYPAPVHQSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@@H]([C@H](CF)N)O.Cl |
Computed by PubChem (NCBI)