CAS 866455-16-5 appears in our catalog under these names: Vernakalant-d6 HCl, Vernakalant-d6 Hydrochloride, Vernakalant-d6 (hydrochloride), 98.95%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 75mg, 5 mg, 1 mg.
(1R,2S)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride (CAS 866455-16-5) is a chemical compound with the molecular formula C10H15ClFNO3S and a molecular weight of 283.75 g/mol. IUPAC name: (1R,2S)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride. InChIKey: HWPBPTAOXVIKGI-DHTOPLTISA-N.
| Molecular formula | C10H15ClFNO3S |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | (1R,2S)-2-amino-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol;hydrochloride |
| InChIKey | HWPBPTAOXVIKGI-DHTOPLTISA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)N)O.Cl |
Computed by PubChem (NCBI)