Products 1391077-84-1
CAS 1391077-84-1 is the registry number for (2-(Trifluoromethyl)indolin-6-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-(trifluoromethyl)-2,3-dihydro-1H-indol-6-yl]methanol (CAS 1391077-84-1) is a chemical compound with the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. IUPAC name: [2-(trifluoromethyl)-2,3-dihydro-1H-indol-6-yl]methanol. InChIKey: NOCFLWJIOOJVBA-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO |
|---|---|
| Molecular weight | 217.19 g/mol |
| IUPAC name | [2-(trifluoromethyl)-2,3-dihydro-1H-indol-6-yl]methanol |
| InChIKey | NOCFLWJIOOJVBA-UHFFFAOYSA-N |
| SMILES | C1C(NC2=C1C=CC(=C2)CO)C(F)(F)F |
Computed by PubChem (NCBI)