Products 1391272-62-0

CAS 1391272-62-0 is the registry number for 1,1,4-Trioxo-2H,3H-benzo(E)thiin-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,1,4-trioxo-2,3-dihydrothiochromene-6-carboxylic acid (CAS 1391272-62-0) is a chemical compound with the molecular formula C10H8O5S and a molecular weight of 240.23 g/mol. IUPAC name: 1,1,4-trioxo-2,3-dihydrothiochromene-6-carboxylic acid. InChIKey: SGFXIDLTVDYRHV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O5S
Molecular weight240.23 g/mol
IUPAC name1,1,4-trioxo-2,3-dihydrothiochromene-6-carboxylic acid
InChIKeySGFXIDLTVDYRHV-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)C2=C(C1=O)C=C(C=C2)C(=O)O

Computed by PubChem (NCBI)