CAS 2097914-73-1 is the registry number for 4-Oxo-4H-chromen-7-yl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-oxochromen-7-yl) methanesulfonate (CAS 2097914-73-1) is a chemical compound with the molecular formula C10H8O5S and a molecular weight of 240.23 g/mol. IUPAC name: (4-oxochromen-7-yl) methanesulfonate. InChIKey: SNEVYWQAVJSQAV-UHFFFAOYSA-N.
| Molecular formula | C10H8O5S |
|---|---|
| Molecular weight | 240.23 g/mol |
| IUPAC name | (4-oxochromen-7-yl) methanesulfonate |
| InChIKey | SNEVYWQAVJSQAV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC2=C(C=C1)C(=O)C=CO2 |
Computed by PubChem (NCBI)