CAS 1391375-27-1 appears in our catalog under these names: (2S)-2-(4-Chlorophenyl)piperidine hydrochloride, 98%, 98%, (S)-2-(4-Chlorophenyl)piperidine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(4-chlorophenyl)piperidine;hydrochloride (CAS 1391375-27-1) is a chemical compound with the molecular formula C11H15Cl2N and a molecular weight of 232.15 g/mol. IUPAC name: (2S)-2-(4-chlorophenyl)piperidine;hydrochloride. InChIKey: POXMBRSBLGHIQE-MERQFXBCSA-N.
| Molecular formula | C11H15Cl2N |
|---|---|
| Molecular weight | 232.15 g/mol |
| IUPAC name | (2S)-2-(4-chlorophenyl)piperidine;hydrochloride |
| InChIKey | POXMBRSBLGHIQE-MERQFXBCSA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)