Products 1391385-57-1
CAS 1391385-57-1 appears in our catalog under these names: CaV1·3 antagonist–1, CaV1.3 antagonist-1, 98.38%, 1-(3-Chlorophenethyl)-3-cyclopentylpyrimidine-2,4,6-(1H,3H,5H)-trione. Offered by: GLPBio, MedChemExpress, Biosynth. Available pack sizes: 10mg, 25mg, 5 mg, 25 mg, 10mM/1mL, 100 mg, 10 mg, 50 mg.
1-[2-(3-chlorophenyl)ethyl]-3-cyclopentyl-1,3-diazinane-2,4,6-trione (CAS 1391385-57-1) is a chemical compound with the molecular formula C17H19ClN2O3 and a molecular weight of 334.8 g/mol. IUPAC name: 1-[2-(3-chlorophenyl)ethyl]-3-cyclopentyl-1,3-diazinane-2,4,6-trione. InChIKey: AJKSBVCOTKODMF-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O3 |
|---|---|
| Molecular weight | 334.8 g/mol |
| IUPAC name | 1-[2-(3-chlorophenyl)ethyl]-3-cyclopentyl-1,3-diazinane-2,4,6-trione |
| InChIKey | AJKSBVCOTKODMF-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C(=O)CC(=O)N(C2=O)CCC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)