CAS 858884-24-9 is the registry number for Methyl 2-((R)-2-amino-2-phenylacetamido)-2-phenylacetate hydrochloride. Offered by: TRC. Available pack sizes: 750mg.
Methyl (2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-phenylacetate;hydrochloride (CAS 858884-24-9) is a chemical compound with the molecular formula C17H19ClN2O3 and a molecular weight of 334.8 g/mol. IUPAC name: methyl (2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-phenylacetate;hydrochloride. InChIKey: QYJFRUUDGSGCGY-CTHHTMFSSA-N.
| Molecular formula | C17H19ClN2O3 |
|---|---|
| Molecular weight | 334.8 g/mol |
| IUPAC name | methyl (2R)-2-[[(2R)-2-amino-2-phenylacetyl]amino]-2-phenylacetate;hydrochloride |
| InChIKey | QYJFRUUDGSGCGY-CTHHTMFSSA-N |
| SMILES | COC(=O)[C@@H](C1=CC=CC=C1)NC(=O)[C@@H](C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)