Products 1391407-62-7
CAS 1391407-62-7 appears in our catalog under these names: (R)-2-(4-(Trifluoromethyl)phenyl)pyrrolidine hydrochloride, 95%, (R)–2–(4–(Trifluoromethyl)phenyl)pyrrolidine hydrochloride, (R)-2-(4-(Trifluoromethyl)phenyl)pyrrolidine hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2R)-2-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1391407-62-7) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: (2R)-2-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: XHVVDNXOJJAMDE-HNCPQSOCSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | (2R)-2-[4-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | XHVVDNXOJJAMDE-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)