CAS 29813-02-3 is the registry number for 1-{[4-(trifluoromethyl)phenyl]methyl}cyclopropan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine;hydrochloride (CAS 29813-02-3) is a chemical compound with the molecular formula C11H13ClF3N and a molecular weight of 251.67 g/mol. IUPAC name: 1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine;hydrochloride. InChIKey: WUMSZDYCSXVYMA-UHFFFAOYSA-N.
| Molecular formula | C11H13ClF3N |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 1-[[4-(trifluoromethyl)phenyl]methyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | WUMSZDYCSXVYMA-UHFFFAOYSA-N |
| SMILES | C1CC1(CC2=CC=C(C=C2)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)