CAS 1391408-54-0 is the registry number for (R)–2–(2–Fluoro–5–(trifluoromethyl)phenyl)pyrrolidine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2R)-2-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride (CAS 1391408-54-0) is a chemical compound with the molecular formula C11H12ClF4N and a molecular weight of 269.66 g/mol. IUPAC name: (2R)-2-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride. InChIKey: WGYMMHPMADAZKR-HNCPQSOCSA-N.
| Molecular formula | C11H12ClF4N |
|---|---|
| Molecular weight | 269.66 g/mol |
| IUPAC name | (2R)-2-[2-fluoro-5-(trifluoromethyl)phenyl]pyrrolidine;hydrochloride |
| InChIKey | WGYMMHPMADAZKR-HNCPQSOCSA-N |
| SMILES | C1C[C@@H](NC1)C2=C(C=CC(=C2)C(F)(F)F)F.Cl |
Computed by PubChem (NCBI)