CAS 1812175-03-3 is the registry number for Rel-(1s,3s)-3-fluoro-3-(4-(trifluoromethyl)phenyl)cyclobutan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride (CAS 1812175-03-3) is a chemical compound with the molecular formula C11H12ClF4N and a molecular weight of 269.66 g/mol. IUPAC name: 3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride. InChIKey: IMVJYVSDRIWYEB-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF4N |
|---|---|
| Molecular weight | 269.66 g/mol |
| IUPAC name | 3-fluoro-3-[4-(trifluoromethyl)phenyl]cyclobutan-1-amine;hydrochloride |
| InChIKey | IMVJYVSDRIWYEB-UHFFFAOYSA-N |
| SMILES | C1C(CC1(C2=CC=C(C=C2)C(F)(F)F)F)N.Cl |
Computed by PubChem (NCBI)