CAS 1391444-61-3 appears in our catalog under these names: (2R)-2-Amino-2-[4-(tert-butyl)phenyl]ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(4–(tert–butyl)phenyl)ethanol hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2R)-2-amino-2-(4-tert-butylphenyl)ethanol;hydrochloride (CAS 1391444-61-3) is a chemical compound with the molecular formula C12H20ClNO and a molecular weight of 229.74 g/mol. IUPAC name: (2R)-2-amino-2-(4-tert-butylphenyl)ethanol;hydrochloride. InChIKey: XZLMNRBNEGHVNB-MERQFXBCSA-N.
| Molecular formula | C12H20ClNO |
|---|---|
| Molecular weight | 229.74 g/mol |
| IUPAC name | (2R)-2-amino-2-(4-tert-butylphenyl)ethanol;hydrochloride |
| InChIKey | XZLMNRBNEGHVNB-MERQFXBCSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)