CAS 2203940-81-0 is the registry number for 1-(4-Isopropoxy-2-methyl-phenyl)-ethylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2-methyl-4-propan-2-yloxyphenyl)ethanamine;hydrochloride (CAS 2203940-81-0) is a chemical compound with the molecular formula C12H20ClNO and a molecular weight of 229.74 g/mol. IUPAC name: 1-(2-methyl-4-propan-2-yloxyphenyl)ethanamine;hydrochloride. InChIKey: PSUIMXBAZIWSOC-UHFFFAOYSA-N.
| Molecular formula | C12H20ClNO |
|---|---|
| Molecular weight | 229.74 g/mol |
| IUPAC name | 1-(2-methyl-4-propan-2-yloxyphenyl)ethanamine;hydrochloride |
| InChIKey | PSUIMXBAZIWSOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC(C)C)C(C)N.Cl |
Computed by PubChem (NCBI)