CAS 1391510-98-7 appears in our catalog under these names: (S)-3-(p-Tolyl)morpholine hydrochloride, 97%, (S)–3–(p–Tolyl)morpholine hydrochloride. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(3S)-3-(4-methylphenyl)morpholine;hydrochloride (CAS 1391510-98-7) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (3S)-3-(4-methylphenyl)morpholine;hydrochloride. InChIKey: GBEZZTSPCWVJES-RFVHGSKJSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (3S)-3-(4-methylphenyl)morpholine;hydrochloride |
| InChIKey | GBEZZTSPCWVJES-RFVHGSKJSA-N |
| SMILES | CC1=CC=C(C=C1)[C@H]2COCCN2.Cl |
Computed by PubChem (NCBI)