CAS 13916-98-8 appears in our catalog under these names: 8-Fluoronaphthalen-2-ol, 98%, 8-Fluoronaphthalen-2-ol 95%, 8-Fluoronaphthalen-2-ol, 95%, 95%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
8-fluoronaphthalen-2-ol (CAS 13916-98-8) is a chemical compound with the molecular formula C10H7FO and a molecular weight of 162.16 g/mol. IUPAC name: 8-fluoronaphthalen-2-ol. InChIKey: BBPLRENRRYYWPO-UHFFFAOYSA-N.
| Molecular formula | C10H7FO |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 8-fluoronaphthalen-2-ol |
| InChIKey | BBPLRENRRYYWPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)F |
Computed by PubChem (NCBI)