CAS 315-53-7 appears in our catalog under these names: 4-Fluoro-1-naphthalenol, >95% (HPLC), 4–Fluoronaphthalen–1–ol, 4-Fluoronaphthalen-1-ol 95%, 4-Fluoro-1-naphthalenol, 95%, 95%, 4-Fluoronaphthalen-1-ol, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg, 25g.
4-fluoronaphthalen-1-ol (CAS 315-53-7) is a chemical compound with the molecular formula C10H7FO and a molecular weight of 162.16 g/mol. IUPAC name: 4-fluoronaphthalen-1-ol. InChIKey: QOJVIUUAFONRTL-UHFFFAOYSA-N.
| Molecular formula | C10H7FO |
|---|---|
| Molecular weight | 162.16 g/mol |
| IUPAC name | 4-fluoronaphthalen-1-ol |
| InChIKey | QOJVIUUAFONRTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2F)O |
Computed by PubChem (NCBI)