CAS 1391636-49-9 appears in our catalog under these names: (trans–2–(o–tolyl)cyclopropyl)methanol, (trans-2-(o-tolyl)cyclopropyl)methanol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg.
[(1R,2R)-2-(2-methylphenyl)cyclopropyl]methanol (CAS 1391636-49-9) is a chemical compound with the molecular formula C11H14O and a molecular weight of 162.23 g/mol. IUPAC name: [(1R,2R)-2-(2-methylphenyl)cyclopropyl]methanol. InChIKey: CVASUYDWRNVMAY-GXSJLCMTSA-N.
| Molecular formula | C11H14O |
|---|---|
| Molecular weight | 162.23 g/mol |
| IUPAC name | [(1R,2R)-2-(2-methylphenyl)cyclopropyl]methanol |
| InChIKey | CVASUYDWRNVMAY-GXSJLCMTSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]2C[C@H]2CO |
Computed by PubChem (NCBI)