Products 1391636-72-8

CAS 1391636-72-8 is the registry number for 2-(3,3-Diethyl-1-triazenyl)-4-methylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g.

Structural formula: {0} (CAS {1})

2-(diethylaminodiazenyl)-4-methylbenzenesulfonyl chloride (CAS 1391636-72-8) is a chemical compound with the molecular formula C11H16ClN3O2S and a molecular weight of 289.78 g/mol. IUPAC name: 2-(diethylaminodiazenyl)-4-methylbenzenesulfonyl chloride. InChIKey: PDGZSZLMBJSDQC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClN3O2S
Molecular weight289.78 g/mol
IUPAC name2-(diethylaminodiazenyl)-4-methylbenzenesulfonyl chloride
InChIKeyPDGZSZLMBJSDQC-UHFFFAOYSA-N
SMILESCCN(CC)N=NC1=C(C=CC(=C1)C)S(=O)(=O)Cl

Computed by PubChem (NCBI)