CAS 848369-69-7 appears in our catalog under these names: 2-Chloro-5-((4-methylpiperazin-1-yl)sulfonyl)aniline, 95+%, 2-Chloro-5-((4-methylpiperazin-1-yl)sulfonyl)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-chloro-5-(4-methylpiperazin-1-yl)sulfonylaniline (CAS 848369-69-7) is a chemical compound with the molecular formula C11H16ClN3O2S and a molecular weight of 289.78 g/mol. IUPAC name: 2-chloro-5-(4-methylpiperazin-1-yl)sulfonylaniline. InChIKey: FHORSCVYNQWSDW-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O2S |
|---|---|
| Molecular weight | 289.78 g/mol |
| IUPAC name | 2-chloro-5-(4-methylpiperazin-1-yl)sulfonylaniline |
| InChIKey | FHORSCVYNQWSDW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)S(=O)(=O)C2=CC(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)