Products 1391733-66-6
CAS 1391733-66-6 appears in our catalog under these names: 4,6-Dimethylpicolinic acid hydrochloride, 95%, 4,6-Dimethylpicolinic acid hydrochloride, 95+%, 4，6–Dimethylpicolinic acid hydrochloride, 4,6-Dimethylpicolinic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg, 0,5g.
4,6-dimethylpyridine-2-carboxylic acid;hydrochloride (CAS 1391733-66-6) is a chemical compound with the molecular formula C8H10ClNO2 and a molecular weight of 187.62 g/mol. IUPAC name: 4,6-dimethylpyridine-2-carboxylic acid;hydrochloride. InChIKey: KSQQSMFNZGTLHY-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2 |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 4,6-dimethylpyridine-2-carboxylic acid;hydrochloride |
| InChIKey | KSQQSMFNZGTLHY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)C(=O)O)C.Cl |
Computed by PubChem (NCBI)