CAS 1391930-18-9 appears in our catalog under these names: 2,2'-Sulfonylbisethanol-13C4, 2,2'-Sulfonyldiethanol-13C4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10 mg, 5 mg, 25 mg.
2-(2-hydroxy(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethanol (CAS 1391930-18-9) is a chemical compound with the molecular formula C4H10O4S and a molecular weight of 158.16 g/mol. IUPAC name: 2-(2-hydroxy(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethanol. InChIKey: QQLILYBIARWEIF-JCDJMFQYSA-N.
| Molecular formula | C4H10O4S |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 2-(2-hydroxy(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethanol |
| InChIKey | QQLILYBIARWEIF-JCDJMFQYSA-N |
| SMILES | [13CH2]([13CH2]S(=O)(=O)[13CH2][13CH2]O)O |
Computed by PubChem (NCBI)