Products 96617-81-1
CAS 96617-81-1 appears in our catalog under these names: Parecoxib Impurity 45-d10 (Diethyl Sulfate-d10), Diethyl Sulfate-d10, >95% (GC), Diethyl sulfate-d10. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 25mg, 50mg, 5mg, 0,1g.
Bis(1,1,2,2,2-pentadeuterioethyl) sulfate (CAS 96617-81-1) is a chemical compound with the molecular formula C4H10O4S and a molecular weight of 164.25 g/mol. IUPAC name: bis(1,1,2,2,2-pentadeuterioethyl) sulfate. InChIKey: DENRZWYUOJLTMF-MWUKXHIBSA-N.
| Molecular formula | C4H10O4S |
|---|---|
| Molecular weight | 164.25 g/mol |
| IUPAC name | bis(1,1,2,2,2-pentadeuterioethyl) sulfate |
| InChIKey | DENRZWYUOJLTMF-MWUKXHIBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OS(=O)(=O)OC([2H])([2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)