Products 1392224-59-7
CAS 1392224-59-7 is the registry number for MyomiRs-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[5-(2a-methoxy-3,8-dioxo-1-phenyl-8aH-cyclobuta[b]naphthalen-2-yl)quinolin-8-yl] tert-butyl carbonate (CAS 1392224-59-7) is a chemical compound with the molecular formula C33H27NO6 and a molecular weight of 533.6 g/mol. IUPAC name: [5-(2a-methoxy-3,8-dioxo-1-phenyl-8aH-cyclobuta[b]naphthalen-2-yl)quinolin-8-yl] tert-butyl carbonate. InChIKey: GNUJEUMWYJVRKO-UHFFFAOYSA-N.
| Molecular formula | C33H27NO6 |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | [5-(2a-methoxy-3,8-dioxo-1-phenyl-8aH-cyclobuta[b]naphthalen-2-yl)quinolin-8-yl] tert-butyl carbonate |
| InChIKey | GNUJEUMWYJVRKO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=C2C(=C(C=C1)C3=C(C4C3(C(=O)C5=CC=CC=C5C4=O)OC)C6=CC=CC=C6)C=CC=N2 |
Computed by PubChem (NCBI)