Products 1392467-07-0
CAS 1392467-07-0 appears in our catalog under these names: 5-(tert-Butoxy)picolinic acid, 95%, 5-(tert-Butoxy)picolinic acid, 98%, 5-(tert-Butoxy)pyridine-2-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g, 50mg.
5-[(2-methylpropan-2-yl)oxy]pyridine-2-carboxylic acid (CAS 1392467-07-0) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 5-[(2-methylpropan-2-yl)oxy]pyridine-2-carboxylic acid. InChIKey: ZTRGDTSIOIZIPS-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 5-[(2-methylpropan-2-yl)oxy]pyridine-2-carboxylic acid |
| InChIKey | ZTRGDTSIOIZIPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CN=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)