CAS 1392517-50-8 is the registry number for tert-Butyl 3-bromoisoxazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-1,2-oxazole-5-carboxylate (CAS 1392517-50-8) is a chemical compound with the molecular formula C8H10BrNO3 and a molecular weight of 248.07 g/mol. IUPAC name: tert-butyl 3-bromo-1,2-oxazole-5-carboxylate. InChIKey: GGSNWXAZPJCXIH-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3 |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | tert-butyl 3-bromo-1,2-oxazole-5-carboxylate |
| InChIKey | GGSNWXAZPJCXIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NO1)Br |
Computed by PubChem (NCBI)