Products 2891607-13-7

CAS 2891607-13-7 is the registry number for 2-(3-Bromoisoxazol-5-yl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid (CAS 2891607-13-7) is a chemical compound with the molecular formula C8H10BrNO3 and a molecular weight of 248.07 g/mol. IUPAC name: 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid. InChIKey: NERBPYKANSEFDS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H10BrNO3
Molecular weight248.07 g/mol
IUPAC name2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid
InChIKeyNERBPYKANSEFDS-UHFFFAOYSA-N
SMILESCC(C)C(C1=CC(=NO1)Br)C(=O)O

Computed by PubChem (NCBI)