CAS 2891607-13-7 is the registry number for 2-(3-Bromoisoxazol-5-yl)-3-methylbutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid (CAS 2891607-13-7) is a chemical compound with the molecular formula C8H10BrNO3 and a molecular weight of 248.07 g/mol. IUPAC name: 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid. InChIKey: NERBPYKANSEFDS-UHFFFAOYSA-N.
| Molecular formula | C8H10BrNO3 |
|---|---|
| Molecular weight | 248.07 g/mol |
| IUPAC name | 2-(3-bromo-1,2-oxazol-5-yl)-3-methylbutanoic acid |
| InChIKey | NERBPYKANSEFDS-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=NO1)Br)C(=O)O |
Computed by PubChem (NCBI)