Products 1392745-31-1
CAS 1392745-31-1 appears in our catalog under these names: (R)-3-(Methylsulfonyl)pyrrolidine hydrochloride, 98%, (R)-3-(Methylsulfonyl)pyrrolidine HCl ee, (R)-3-(methylsulfonyl)pyrrolidine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 0,5g, 500mg.
(3R)-3-methylsulfonylpyrrolidine;hydrochloride (CAS 1392745-31-1) is a chemical compound with the molecular formula C5H12ClNO2S and a molecular weight of 185.67 g/mol. IUPAC name: (3R)-3-methylsulfonylpyrrolidine;hydrochloride. InChIKey: LRCGEDCMPFJUSI-NUBCRITNSA-N.
| Molecular formula | C5H12ClNO2S |
|---|---|
| Molecular weight | 185.67 g/mol |
| IUPAC name | (3R)-3-methylsulfonylpyrrolidine;hydrochloride |
| InChIKey | LRCGEDCMPFJUSI-NUBCRITNSA-N |
| SMILES | CS(=O)(=O)[C@@H]1CCNC1.Cl |
Computed by PubChem (NCBI)