CAS 1958091-83-2 is the registry number for (R)-3-Amino-3-methyltetrahydrothiophene 1,1-dioxide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R)-3-methyl-1,1-dioxothiolan-3-amine;hydrochloride (CAS 1958091-83-2) is a chemical compound with the molecular formula C5H12ClNO2S and a molecular weight of 185.67 g/mol. IUPAC name: (3R)-3-methyl-1,1-dioxothiolan-3-amine;hydrochloride. InChIKey: QXTFWVCBUONAOS-NUBCRITNSA-N.
| Molecular formula | C5H12ClNO2S |
|---|---|
| Molecular weight | 185.67 g/mol |
| IUPAC name | (3R)-3-methyl-1,1-dioxothiolan-3-amine;hydrochloride |
| InChIKey | QXTFWVCBUONAOS-NUBCRITNSA-N |
| SMILES | C[C@]1(CCS(=O)(=O)C1)N.Cl |
Computed by PubChem (NCBI)