Products 1392804-12-4
CAS 1392804-12-4 appears in our catalog under these names: 6–Thia–1–azaspiro(3·3)heptane 6，6–dioxide hemioxalate, 6-Thia-1-azaspiro(3.3)heptane 6,6-dioxide hemioxalate, 6-Thia-1-azaspiro[3.3]heptane 6,6-dioxid, e hemioxalate, 5 mg, 6-Thia-1-azaspiro[3.3]heptane 6,6-dioxid, e hemioxalate, 10 mg, 6-Thia-1-azaspiro[3.3]heptane 6,6-dioxid, e hemioxalate, 25 mg. Offered by: GLPBio, Biosynth, Roth. Available pack sizes: 250mg, 10mg, 5mg, 25mg, 50mg, 100mg.
6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;oxalic acid (CAS 1392804-12-4) is a chemical compound with the molecular formula C7H11NO6S and a molecular weight of 237.23 g/mol. IUPAC name: 6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;oxalic acid. InChIKey: AKFMMYCPJWBURC-UHFFFAOYSA-N.
| Molecular formula | C7H11NO6S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 6lambda6-thia-1-azaspiro[3.3]heptane 6,6-dioxide;oxalic acid |
| InChIKey | AKFMMYCPJWBURC-UHFFFAOYSA-N |
| SMILES | C1CNC12CS(=O)(=O)C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)