Products 1394319-61-9
CAS 1394319-61-9 is the registry number for 6-Thia-1-azaspiro[3.3]heptane 6,6-dioxide oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
1lambda6-thia-6-azaspiro[3.3]heptane 1,1-dioxide;oxalic acid (CAS 1394319-61-9) is a chemical compound with the molecular formula C7H11NO6S and a molecular weight of 237.23 g/mol. IUPAC name: 1lambda6-thia-6-azaspiro[3.3]heptane 1,1-dioxide;oxalic acid. InChIKey: JIKISWWIXPZYDW-UHFFFAOYSA-N.
| Molecular formula | C7H11NO6S |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 1lambda6-thia-6-azaspiro[3.3]heptane 1,1-dioxide;oxalic acid |
| InChIKey | JIKISWWIXPZYDW-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C12CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)