CAS 139334-63-7 is the registry number for Ethyl (2R)-4-Methyl-1-((S)-1-phenylethyl)piperidine-2-carboxylate. Offered by: TRC. Available pack sizes: 250mg.
Ethyl (2R)-4-methyl-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate (CAS 139334-63-7) is a chemical compound with the molecular formula C17H25NO2 and a molecular weight of 275.4 g/mol. IUPAC name: ethyl (2R)-4-methyl-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate. InChIKey: VCWVJJJJCQJWOU-JGKCFBKVSA-N.
| Molecular formula | C17H25NO2 |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | ethyl (2R)-4-methyl-1-[(1S)-1-phenylethyl]piperidine-2-carboxylate |
| InChIKey | VCWVJJJJCQJWOU-JGKCFBKVSA-N |
| SMILES | CCOC(=O)[C@H]1CC(CCN1[C@@H](C)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)