Products 1393441-53-6
CAS 1393441-53-6 appears in our catalog under these names: RY796, 98%, RY796, RY796, 98.59%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 10mg, 25mg, 5mg, 50mg, 10 mg, 25 mg.
2-(dimethylamino)-5-(2-methylpropanoylamino)-N-[(1R)-1-phenylethyl]benzamide (CAS 1393441-53-6) is a chemical compound with the molecular formula C21H27N3O2 and a molecular weight of 353.5 g/mol. IUPAC name: 2-(dimethylamino)-5-(2-methylpropanoylamino)-N-[(1R)-1-phenylethyl]benzamide. InChIKey: LDXZFQWWXMRMAS-OAHLLOKOSA-N.
| Molecular formula | C21H27N3O2 |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | 2-(dimethylamino)-5-(2-methylpropanoylamino)-N-[(1R)-1-phenylethyl]benzamide |
| InChIKey | LDXZFQWWXMRMAS-OAHLLOKOSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)NC(=O)C2=C(C=CC(=C2)NC(=O)C(C)C)N(C)C |
Computed by PubChem (NCBI)