Products 2255311-93-2
CAS 2255311-93-2 is the registry number for HPGDS inhibitor 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
7-cyclopropyl-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-1,8-naphthyridine-3-carboxamide (CAS 2255311-93-2) is a chemical compound with the molecular formula C21H27N3O2 and a molecular weight of 353.5 g/mol. IUPAC name: 7-cyclopropyl-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-1,8-naphthyridine-3-carboxamide. InChIKey: VEKOTFOGNGVLSE-UHFFFAOYSA-N.
| Molecular formula | C21H27N3O2 |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | 7-cyclopropyl-N-[4-(2-hydroxypropan-2-yl)cyclohexyl]-1,8-naphthyridine-3-carboxamide |
| InChIKey | VEKOTFOGNGVLSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CCC(CC1)NC(=O)C2=CN=C3C(=C2)C=CC(=N3)C4CC4)O |
Computed by PubChem (NCBI)