Products 1393441-85-4

CAS 1393441-85-4 is the registry number for Methyl 3-[3-(benzyloxy)phenyl]-4-fluorobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-fluoro-3-(3-phenylmethoxyphenyl)benzoate (CAS 1393441-85-4) is a chemical compound with the molecular formula C21H17FO3 and a molecular weight of 336.4 g/mol. IUPAC name: methyl 4-fluoro-3-(3-phenylmethoxyphenyl)benzoate. InChIKey: CRDZIVNDFFSPQW-UHFFFAOYSA-N.

Identity
Molecular formulaC21H17FO3
Molecular weight336.4 g/mol
IUPAC namemethyl 4-fluoro-3-(3-phenylmethoxyphenyl)benzoate
InChIKeyCRDZIVNDFFSPQW-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1)F)C2=CC(=CC=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)