Products 351445-97-1

CAS 351445-97-1 is the registry number for Benzyl 2-(benzyloxy)-4-fluorobenzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 4-fluoro-2-phenylmethoxybenzoate (CAS 351445-97-1) is a chemical compound with the molecular formula C21H17FO3 and a molecular weight of 336.4 g/mol. IUPAC name: benzyl 4-fluoro-2-phenylmethoxybenzoate. InChIKey: GOSCYMWPVHDXJI-UHFFFAOYSA-N.

Identity
Molecular formulaC21H17FO3
Molecular weight336.4 g/mol
IUPAC namebenzyl 4-fluoro-2-phenylmethoxybenzoate
InChIKeyGOSCYMWPVHDXJI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=CC(=C2)F)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)