CAS 1393441-88-7 is the registry number for Methyl 2-(5-bromo-4-chloro-2-nitrophenyl)-2-cyanoacetate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 100g, 5g, 1g.
Methyl 2-(5-bromo-4-chloro-2-nitrophenyl)-2-cyanoacetate (CAS 1393441-88-7) is a chemical compound with the molecular formula C10H6BrClN2O4 and a molecular weight of 333.52 g/mol. IUPAC name: methyl 2-(5-bromo-4-chloro-2-nitrophenyl)-2-cyanoacetate. InChIKey: MDXNPQYBWWSCHR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O4 |
|---|---|
| Molecular weight | 333.52 g/mol |
| IUPAC name | methyl 2-(5-bromo-4-chloro-2-nitrophenyl)-2-cyanoacetate |
| InChIKey | MDXNPQYBWWSCHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=CC(=C(C=C1[N+](=O)[O-])Cl)Br |
Computed by PubChem (NCBI)