CAS 2206607-39-6 is the registry number for 5-Bromo-2-chloro-nicotinic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2,5-dioxopyrrolidin-1-yl) 5-bromo-2-chloropyridine-3-carboxylate (CAS 2206607-39-6) is a chemical compound with the molecular formula C10H6BrClN2O4 and a molecular weight of 333.52 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-bromo-2-chloropyridine-3-carboxylate. InChIKey: BOFQGLLYIDKLFO-UHFFFAOYSA-N.
| Molecular formula | C10H6BrClN2O4 |
|---|---|
| Molecular weight | 333.52 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-bromo-2-chloropyridine-3-carboxylate |
| InChIKey | BOFQGLLYIDKLFO-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C2=C(N=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)