CAS 1393442-16-4 is the registry number for 5-Bromo-6-fluoro-1-isopropyl-2-methylbenzimidazole, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 25g.
5-bromo-6-fluoro-2-methyl-1-propan-2-ylbenzimidazole (CAS 1393442-16-4) is a chemical compound with the molecular formula C11H12BrFN2 and a molecular weight of 271.13 g/mol. IUPAC name: 5-bromo-6-fluoro-2-methyl-1-propan-2-ylbenzimidazole. InChIKey: KBZZQXZLCGOZDD-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFN2 |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 5-bromo-6-fluoro-2-methyl-1-propan-2-ylbenzimidazole |
| InChIKey | KBZZQXZLCGOZDD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2N1C(C)C)F)Br |
Computed by PubChem (NCBI)