CAS 2570190-12-2 appears in our catalog under these names: 4-Bromo-1-tert-butyl-6-fluoroindazole, 96%, 4-Bromo-1-(tert-butyl)-6-fluoro-1H-indazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-bromo-1-tert-butyl-6-fluoroindazole (CAS 2570190-12-2) is a chemical compound with the molecular formula C11H12BrFN2 and a molecular weight of 271.13 g/mol. IUPAC name: 4-bromo-1-tert-butyl-6-fluoroindazole. InChIKey: UQOUVTXRCBJRMV-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFN2 |
|---|---|
| Molecular weight | 271.13 g/mol |
| IUPAC name | 4-bromo-1-tert-butyl-6-fluoroindazole |
| InChIKey | UQOUVTXRCBJRMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=CC(=C2)F)Br |
Computed by PubChem (NCBI)