Products 1393442-35-7
CAS 1393442-35-7 is the registry number for Ethyl 2-fluoro-4-(4-formylphenyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 2-fluoro-4-(4-formylphenyl)benzoate (CAS 1393442-35-7) is a chemical compound with the molecular formula C16H13FO3 and a molecular weight of 272.27 g/mol. IUPAC name: ethyl 2-fluoro-4-(4-formylphenyl)benzoate. InChIKey: VGMXGDSSWKQJOW-UHFFFAOYSA-N.
| Molecular formula | C16H13FO3 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | ethyl 2-fluoro-4-(4-formylphenyl)benzoate |
| InChIKey | VGMXGDSSWKQJOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)C2=CC=C(C=C2)C=O)F |
Computed by PubChem (NCBI)