CAS 2270905-99-0 is the registry number for 4-Acetyl-3-fluoro-benzoic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Benzyl 4-acetyl-3-fluorobenzoate (CAS 2270905-99-0) is a chemical compound with the molecular formula C16H13FO3 and a molecular weight of 272.27 g/mol. IUPAC name: benzyl 4-acetyl-3-fluorobenzoate. InChIKey: SDLQMPDTBHNFCF-UHFFFAOYSA-N.
| Molecular formula | C16H13FO3 |
|---|---|
| Molecular weight | 272.27 g/mol |
| IUPAC name | benzyl 4-acetyl-3-fluorobenzoate |
| InChIKey | SDLQMPDTBHNFCF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(=O)OCC2=CC=CC=C2)F |
Computed by PubChem (NCBI)