CAS 1393545-61-3 appears in our catalog under these names: 3-(3-Nitrophenyl)oxetan-3-amine, 98%, 3-(3-Nitrophenyl)oxetan-3-amine hydrochloride, 95%. Offered by: Chemat Brand, Combi-blocks. Available pack sizes: on request, 1g.
3-(3-nitrophenyl)oxetan-3-amine;hydrochloride (CAS 1393545-61-3) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: 3-(3-nitrophenyl)oxetan-3-amine;hydrochloride. InChIKey: HPJGMFQACLUHIK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 3-(3-nitrophenyl)oxetan-3-amine;hydrochloride |
| InChIKey | HPJGMFQACLUHIK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=CC(=CC=C2)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)