CAS 256657-23-5 appears in our catalog under these names: Abz–Gly–OH · HCl, Abz-gly-oh hydrochloride, 98%, Abz-Gly-OH·HCl 97%, ABZ-GLY-OH HCL, 95%, 95%, ABZ-GLY-OH HCL, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 250mg, 100mg.
2-[(2-aminobenzoyl)amino]acetic acid;hydrochloride (CAS 256657-23-5) is a chemical compound with the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. IUPAC name: 2-[(2-aminobenzoyl)amino]acetic acid;hydrochloride. InChIKey: QCVSZXHFZFRVOF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O3 |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 2-[(2-aminobenzoyl)amino]acetic acid;hydrochloride |
| InChIKey | QCVSZXHFZFRVOF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NCC(=O)O)N.Cl |
Computed by PubChem (NCBI)