Products 1393555-53-7
CAS 1393555-53-7 is the registry number for 7-chloro-1,2,3,4-tetrahydro-2,6-naphthyridin-1-one, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
7-chloro-3,4-dihydro-2H-2,6-naphthyridin-1-one (CAS 1393555-53-7) is a chemical compound with the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-3,4-dihydro-2H-2,6-naphthyridin-1-one. InChIKey: HKHLYKKXFCZWLW-UHFFFAOYSA-N.
| Molecular formula | C8H7ClN2O |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-3,4-dihydro-2H-2,6-naphthyridin-1-one |
| InChIKey | HKHLYKKXFCZWLW-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=CC(=NC=C21)Cl |
Computed by PubChem (NCBI)