CAS 1393557-53-3 appears in our catalog under these names: 3-Iodo-5-(trifluoromethyl)acetophenone, 97%, 1-[3-Iodo-5-(trifluoromethyl)phenyl]ethanone, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 250mg.
1-[3-iodo-5-(trifluoromethyl)phenyl]ethanone (CAS 1393557-53-3) is a chemical compound with the molecular formula C9H6F3IO and a molecular weight of 314.04 g/mol. IUPAC name: 1-[3-iodo-5-(trifluoromethyl)phenyl]ethanone. InChIKey: KHZYBONPCLMAAF-UHFFFAOYSA-N.
| Molecular formula | C9H6F3IO |
|---|---|
| Molecular weight | 314.04 g/mol |
| IUPAC name | 1-[3-iodo-5-(trifluoromethyl)phenyl]ethanone |
| InChIKey | KHZYBONPCLMAAF-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)I)C(F)(F)F |
Computed by PubChem (NCBI)