CAS 898787-69-4 appears in our catalog under these names: 3-(4-Iodophenyl)-1,1,1-trifluoro-2-propanone, 95%, 3-(4-Iodophenyl)-1,1,1-trifluoro-2-propanone, ≥95%, 1,1,1-Trifluoro-3-(4-iodophenyl)-2-propanone, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 1g.
1,1,1-trifluoro-3-(4-iodophenyl)propan-2-one (CAS 898787-69-4) is a chemical compound with the molecular formula C9H6F3IO and a molecular weight of 314.04 g/mol. IUPAC name: 1,1,1-trifluoro-3-(4-iodophenyl)propan-2-one. InChIKey: JHQOXKAOUYHDNC-UHFFFAOYSA-N.
| Molecular formula | C9H6F3IO |
|---|---|
| Molecular weight | 314.04 g/mol |
| IUPAC name | 1,1,1-trifluoro-3-(4-iodophenyl)propan-2-one |
| InChIKey | JHQOXKAOUYHDNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C(F)(F)F)I |
Computed by PubChem (NCBI)