CAS 139369-42-9 is the registry number for 4-Chloro-5-(2,3-dichlorophenoxy)-1,2-benzenediamine. Offered by: TRC. Available pack sizes: 100mg.
4-chloro-5-(2,3-dichlorophenoxy)benzene-1,2-diamine (CAS 139369-42-9) is a chemical compound with the molecular formula C12H9Cl3N2O and a molecular weight of 303.6 g/mol. IUPAC name: 4-chloro-5-(2,3-dichlorophenoxy)benzene-1,2-diamine. InChIKey: NNDWEKICDTYSCM-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl3N2O |
|---|---|
| Molecular weight | 303.6 g/mol |
| IUPAC name | 4-chloro-5-(2,3-dichlorophenoxy)benzene-1,2-diamine |
| InChIKey | NNDWEKICDTYSCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OC2=C(C=C(C(=C2)N)N)Cl |
Computed by PubChem (NCBI)