CAS 2172654-75-8 is the registry number for (3-Chloro-6-(2,3-dichlorophenyl)-5-methylpyrazin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[3-chloro-6-(2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol (CAS 2172654-75-8) is a chemical compound with the molecular formula C12H9Cl3N2O and a molecular weight of 303.6 g/mol. IUPAC name: [3-chloro-6-(2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol. InChIKey: KALXHFNQAGCPBH-UHFFFAOYSA-N.
| Molecular formula | C12H9Cl3N2O |
|---|---|
| Molecular weight | 303.6 g/mol |
| IUPAC name | [3-chloro-6-(2,3-dichlorophenyl)-5-methylpyrazin-2-yl]methanol |
| InChIKey | KALXHFNQAGCPBH-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)Cl)CO)C2=C(C(=CC=C2)Cl)Cl |
Computed by PubChem (NCBI)