CAS 139376-06-0 is the registry number for Thiophene, 2,2′,2′′,2′′′-(1,2-ethenediylidene)tetrakis-, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(1,2,2-trithiophen-2-ylethenyl)thiophene (CAS 139376-06-0) is a chemical compound with the molecular formula C18H12S4 and a molecular weight of 356.6 g/mol. IUPAC name: 2-(1,2,2-trithiophen-2-ylethenyl)thiophene. InChIKey: HNHRZULVAOZEJG-UHFFFAOYSA-N.
| Molecular formula | C18H12S4 |
|---|---|
| Molecular weight | 356.6 g/mol |
| IUPAC name | 2-(1,2,2-trithiophen-2-ylethenyl)thiophene |
| InChIKey | HNHRZULVAOZEJG-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=C(C2=CC=CS2)C3=CC=CS3)C4=CC=CS4 |
Computed by PubChem (NCBI)